quảng cáo kqxs full 1
quảng cáo kqxs full 1

TOPIC CHĂN NUÔI BTL K5N THÁNG 10/2018

Thảo luận trong 'CHĂN NUÔI XSMB' bắt đầu bởi dingding, 30/9/18.

Lượt xem: 82,459

Trạng thái chủ đề:
Tạm đóng.
  1. minhquang2015

    minhquang2015 VIP Xổ Số

    Tham gia:
    2/3/15
    Bài viết:
    19,476
    Được thích:
    19,669
    Điểm thành tích:
    113
    Nghề nghiệp:
    BS
    CHĂN NUÔI LOTTO BTL MAX 5 NGÀY THÁNG 10/2018:
    LẦN 1: Chăn BTL 20 K5N (TỪ 01/10 -> 05/10) MISS
    LẦN 2: Chăn BTL 67 K5N (TỪ 06/10 -> 10/10) NHẬN 67* NGÀY 1
    LẦN 3: Chăn BTL 81 K5N (TỪ 07/10 -> 11/10) NHẬN 81* NGÀY 5
    LẦN 4: Chăn BTL 53 K5N (TỪ 12/10 -> 16/10) NHẬN 53** NGÀY 3
    LẦN 5: Chăn BTL 72 K5N (TỪ 15/10 -> 19/10) NHẬN 72* NGÀY 5
    LẦN 6: Chăn BTL 77 K5N (TỪ 20/10 -> 24/10) MISS
    LẦN 7: Chăn BTL 77 K5N (TỪ 25/10 -> 29/10)
     
    Hatay_quelua thích bài này.
  2. dayang1991

    dayang1991 Thành viên kiểm duyệt

    Tham gia:
    12/5/14
    Bài viết:
    57
    Được thích:
    107
    Điểm thành tích:
    33
    Chăn BTL K5N tháng 10
    lần 1: chăn 22 từ 1-5/10 nhận n1
    lần 2: chăn 79 từ 2-6/10 nhận n2
    lần 3: chăn 43 từ 4-8/10 nhận n3
    lần 4: chăn 44 từ 7-11/10 nhận n2
    lần 5: chăn 19 từ 9-13/10 nhận n2
    lần 6: chăn 79 từ 11-15/10 nhận n1
    lần 7: chăn 26 từ 12-16/10 nhận n3
    lần 8: chăn 15 từ 15-19/10 nhận n5
    lần 9: chăn 28 từ ngày 20-24/10 nhận n1
    lần 10: chăn 26 từ ngày 21-25/10 nhận n4
    lần 11: chăn 19 từ 25-29/10 nhận
     
  3. Nguyenanh26

    Nguyenanh26 Thành viên kiểm duyệt

    Tham gia:
    31/7/18
    Bài viết:
    191
    Được thích:
    423
    Điểm thành tích:
    63
    Chăn BTL K5N tháng 10/2018.
    Lần 1: Chăn 03 từ 1-5/10/2018. Nhận 03 ngày 3
    Lần 2: Chăn 25 từ 4-8/10/2018. Nhận 25 ngày 5
    Lần 3: Chăn 31 từ 9-13/10/2018. Nhận 31 ngày 1
    Lần 4: Chăn 74 từ 10-14/10/2018. Nhận 74 ngày 2
    Lần 5: Chăn 57 từ 12-16/10/2018. Nhận 57** ngày 3
    Lần 6: Chăn 25 từ 15-19/10/2018. Nhận 25 ngày 1
    Lần 7: Chăn 21 từ 16-20/10/2018. Nhận 21 ngày 1
    Lần 8: Chăn 27 từ 17-21/10/2017. Nhận 27 ngày 2
    Lần 9: Chăn 42 từ 19-23/10/2018. Nhận 42** Ngày 3
    Lần 10: Chăn 53 từ 22-26/10/2018. Nhận 53 ngày 4
    Lần 11: Chăn 59 từ 26-31/10/2018. Nhận......
    Chúc AE may mắn.
     
    Hatay_quelua, Tuttit, tranduc3312 thành viên khác Thích điều này.
  4. alisemiyen

    alisemiyen Thành viên kiểm duyệt

    Tham gia:
    3/8/11
    Bài viết:
    1,444
    Được thích:
    1,083
    Điểm thành tích:
    113
    Nghề nghiệp:
    số học
    Lần 1: 52 (1-5) nhận 52 ngày 4
    Lần 2: 43 (5-9) nhận 43** ngày 2
    Lần 3: 00 (7-11) nhận 00 ngày 2
    Lần 4: 79 (9-13) nhận 79 ngày 3
    Lần 5: 59 (12-16) nhận 59 ngày 3
    Lần 6: 91 (15-19) nhận 91 ngày 3
    Lần 7: 38 (18-22) xịt
    Lần 8: 91 (23-27) nhận 91 ngày 3
    Lần 9: 67 (26-30)
     
    Hatay_queluaMinhbo1987 thích điều này.
  5. minhlt

    minhlt Thành viên kiểm duyệt

    Tham gia:
    28/3/18
    Bài viết:
    78
    Được thích:
    123
    Điểm thành tích:
    33
    Lần 1. Chăn Btl 65 K5N (01-05/11)Nhận 65 ngày 1.
    Lần 2. Chăn Btl 57 K5N (02-06/11) Nhận 57 ngày 1.
    Lần 3. Chăn Btl 32 K5N (03-07/11) Nhận 32 ngày 5.
    Lần 4. Chăn Btl 14 K5N (08-12/11) Nhận MISS
    Lần 5. Chăn Btl 82 K5N (13-17/11) Nhận 82 ngày 1
    Lần 6. Chăn Btl 11 K5N (14-18/11) Nhận 11 ngày 2
    Lần 7. Chăn Btl 56 K5N (16-20/11) Nhận 56 ngày 5
    Lần 8. Chăn Btl 82 K5N (21-26/11) Nhận 82 ngày 1
    Lần 9. Chăn Btl 23 K5N (22-26/11) Nhận 23 ngày 2

    Lần 10. Chăn Btl 65 K5N (24-28/11) Nhận 65 ngày 2.
    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]Lần 11. Chăn Btl 60 K5N (26-30/11) Nhận 60 ngày ...[/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
     
    Hatay_quelua thích bài này.
  6. vutuanlinh

    vutuanlinh Thành viên kiểm duyệt

    Tham gia:
    13/6/13
    Bài viết:
    53
    Được thích:
    102
    Điểm thành tích:
    33
    Nghề nghiệp:
    Art
    L1 :chăn btl 55 21-25/10 nhận 55n5
    L2 :chăn btl 29 26-30/10....( ae có thể to tay )
     
  7. lamgiaukkho

    lamgiaukkho Thành viên kiểm duyệt

    Tham gia:
    16/3/13
    Bài viết:
    1,023
    Được thích:
    3,690
    Điểm thành tích:
    113
    L1: btl 38 k5n từ 1/10-5/10 nhận 38 n3
    L2: btl 77 k5n từ 4/10-8/10 nhận 77 n1
    L3: btl 07 k5n từ 5/10-9/10 nhận 07 n4
    L4: btl 13 k5n từ 9/10-13/10 nhận 13 n1
    L5: btl 80 k5n từ 10/10-14/10 nhận 80 n1
    L6: btl 97 k5n từ 11/10-15/10 nhận 97 n3
    L7: btl 19 k5n từ 14/10-18/10 nhận 19 n2
    L8: btl 72 k5n từ 16/10-20/10 nhận 72 n4
    L9: btl 47 k5n từ 20/10-24/10 mít
    L10: btl 65 k5n từ 25/10-29/10 nhận 65 n1
    L11: btl 97 k5n từ 26/10-30/10
     
    thangbattai, Tuttit, Minhduc271 and 1 người khác Thích điều này.
  8. chuotnhatxo

    chuotnhatxo Thành viên kiểm duyệt

    Tham gia:
    5/4/18
    Bài viết:
    836
    Được thích:
    2,588
    Điểm thành tích:
    93
    Chăn nuôi STL K5N tháng 10/2018
    Lần 1: Chăn 68 từ 1-5/10 nhận 68 N4
    Lần 2: Chăn 40 từ 5-9/10 nhận xit
    Lần 3: Chăn 81 từ 10-14/10 nhận N2
    Lần 4: Chăn 20 từ 12-16/10 nhận xit
    Lần 5: Chăn 26 từ 17-21/10 nhận xit
    Lần 6: Chăn 10 từ 22-26/10 nhận N1
    Lần 7: Chăn 02 từ 23-27/10 nhận N3
    Lần 8: Chăn 09 từ 26-30/10 nhận …
     
    Hatay_quelua thích bài này.
  9. minhlt

    minhlt Thành viên kiểm duyệt

    Tham gia:
    28/3/18
    Bài viết:
    78
    Được thích:
    123
    Điểm thành tích:
    33
    Lần 1. Chăn Btl 65 K5N (01-05/11)Nhận 65 ngày 1.
    Lần 2. Chăn Btl 57 K5N (02-06/11) Nhận 57 ngày 1.
    Lần 3. Chăn Btl 32 K5N (03-07/11) Nhận 32 ngày 5.
    Lần 4. Chăn Btl 14 K5N (08-12/11) Nhận MISS
    Lần 5. Chăn Btl 82 K5N (13-17/11) Nhận 82 ngày 1
    Lần 6. Chăn Btl 11 K5N (14-18/11) Nhận 11 ngày 2
    Lần 7. Chăn Btl 56 K5N (16-20/11) Nhận 56 ngày 5
    Lần 8. Chăn Btl 82 K5N (21-26/11) Nhận 82 ngày 1
    Lần 9. Chăn Btl 23 K5N (22-26/11) Nhận 23 ngày 2
    Lần 10. Chăn Btl 65 K5N (24-28/11) Nhận 65 ngày 2.

    Lần 11. Chăn Btl 60 K5N (26-30/11) Nhận 60 ngày ...
     
    Hatay_quelua thích bài này.
  10. rauduaquangay

    rauduaquangay Lính mới

    Tham gia:
    16/12/17
    Bài viết:
    132
    Được thích:
    286
    Điểm thành tích:
    63
    Chăn BTL k5n tháng 10/2018( chịu khó chăn kiếm ít cháo vậy)
    L1 : chăn 27 từ (01-05/10) nhận N1
    L2: chăn 33 từ (02-06/10) nhận N4 **
    L3: chăn 88 từ (06-10/10) nhận N2 khung này ko phải nghĩ băm to
    L4: chăn 25 từ (08-12/10) nhận N1 khung này chén cao
    L5:chăn 81 từ (09-13/10) nhận N3 chén nó
    L6:chăn 69 từ (12-16/10) nhận N1**
    L7:chăn 67 từ (13-17/10) nhận N4
    L8: chăn 94 từ (17-21/10) nhận N1.khung này to được
    L9: chăn 69 từ (18-22/10) nhận Xịt lòi tĩ
    L10: chăn 69 từ (23-27/10) nhận N.lại lòi trĩ
    L11: chăn 11 từ (28-31/10) đập chết cu đồng , ko ra a xin từ bỏ nghiệp lô đề cho mày chơi 1 mình
     
    Hatay_queluaHaiphongtnvn123 thích điều này.
  11. TomVip

    TomVip Thành viên kiểm duyệt

    Tham gia:
    20/11/17
    Bài viết:
    832
    Được thích:
    1,905
    Điểm thành tích:
    93
    CHĂN BTL K5N T10/2018
    + LẦN 1: CHĂN BTL 44 K5N (TỪ 01-05/10)NHẬN N1
    + LẦN 2: CHĂN BTL 68 K5N (TỪ 02-06/10)NHẬN N3
    + LẦN 3: CHĂN BTL 90 K5N (TỪ 05-09/10)NHẬN N2
    + LẦN 4: CHĂN BTL 07 K5N (TỪ 07-11/10)NHẬN N2
    + LẦN 5: CHĂN BTL 50 K5N (TỪ 09-13/10)NHẬN N3
    + LẦN 6: CHĂN BTL 94 K5N (TỪ 12-16/10) MISS
    + LẦN 7: CHĂN BTL 93 K5N (TỪ 17-21/10)NHẬN N1
    + LẦN 8: CHĂN BTL 87 K5N (TỪ 18-22/10)NHẬN N2
    + LẦN 9: CHĂN BTL 53 K5N (TỪ 20-24/10)MISS
    +LẦN 10: CHĂN BTL 03 K5N (TỪ 25-29/10)NHẬN N4
    +LẦN 11: CHĂN BTL 31 K5N (TỪ 28-31/10)NHẬN....
     
    Hatay_quelua thích bài này.
  12. datviet1na

    datviet1na Thành viên kiểm duyệt

    Tham gia:
    8/2/11
    Bài viết:
    2,129
    Được thích:
    1,854
    Điểm thành tích:
    113
    Nghề nghiệp:
    Bơ vơ
    Chăn BTL K5N tháng 10/2018
    Lần 1: chăn 47 (từ 01 - 05/10). Nhận 47* N1.
    Lần 2: chăn 17 (từ 02 - 06/10). Miss
    Lần 3: chăn 00 (từ 07 - 11/10). Nhận 00* N2.
    Nghỉ 11-12/10.
    Lần 4: chăn 35 (từ 13 - 17/10). Nhận 35* N3
    Lần 5: chăn 56 (từ 16 - 20/10). Nhận 56* N5
    Lần 6: chăn 41 (từ 21 - 25/10). Miss
    Lần 7: chăn 98 (từ 29 - 31/10)
     
    Hatay_quelua thích bài này.
  13. rauduaquangay

    rauduaquangay Lính mới

    Tham gia:
    16/12/17
    Bài viết:
    132
    Được thích:
    286
    Điểm thành tích:
    63
    Chăn BTL k5n tháng 10/2018( chịu khó chăn kiếm ít cháo vậy)
    L1 : chăn 27 từ (01-05/10) nhận N1
    L2: chăn 33 từ (02-06/10) nhận N4 **
    L3: chăn 88 từ (06-10/10) nhận N2 khung này ko phải nghĩ băm to
    L4: chăn 25 từ (08-12/10) nhận N1 khung này chén cao
    L5:chăn 81 từ (09-13/10) nhận N3 chén nó
    L6:chăn 69 từ (12-16/10) nhận N1**
    L7:chăn 67 từ (13-17/10) nhận N4
    L8: chăn 94 từ (17-21/10) nhận N1.khung này to được
    L9: chăn 69 từ (18-22/10) nhận Xịt lòi tĩ
    L10: chăn 69 từ (23-27/10) nhận N.lại lòi trĩ
    L11: chăn 11 từ (28-31/10) đập chết cu đồng , ko ra a xin từ bỏ nghiệp lô đề cho mày chơi 1 mình Nhận N2
    L12: chăn 32 từ (30-31/10) ăn luôn ngày N..
     
  14. minhquang2015

    minhquang2015 VIP Xổ Số

    Tham gia:
    2/3/15
    Bài viết:
    19,476
    Được thích:
    19,669
    Điểm thành tích:
    113
    Nghề nghiệp:
    BS
    CHĂN NUÔI LOTTO BTL MAX 5 NGÀY THÁNG 10/2018:
    LẦN 1: Chăn BTL 20 K5N (TỪ 01/10 -> 05/10) MISS
    LẦN 2: Chăn BTL 67 K5N (TỪ 06/10 -> 10/10) NHẬN 67* NGÀY 1
    LẦN 3: Chăn BTL 81 K5N (TỪ 07/10 -> 11/10) NHẬN 81* NGÀY 5
    LẦN 4: Chăn BTL 53 K5N (TỪ 12/10 -> 16/10) NHẬN 53** NGÀY 3
    LẦN 5: Chăn BTL 72 K5N (TỪ 15/10 -> 19/10) NHẬN 72* NGÀY 5
    LẦN 6: Chăn BTL 77 K5N (TỪ 20/10 -> 24/10) MISS
    LẦN 7: Chăn BTL 77 K5N (TỪ 25/10 -> 29/10) MISS
    LẦN 8: Chăn BTL 57 K5N (TỪ 30/10 -> 31/10)
     
    Hatay_quelua thích bài này.
  15. minhlt

    minhlt Thành viên kiểm duyệt

    Tham gia:
    28/3/18
    Bài viết:
    78
    Được thích:
    123
    Điểm thành tích:
    33
    Lần 1. Chăn Btl 65 K5N (01-05/11)Nhận 65 ngày 1.
    Lần 2. Chăn Btl 57 K5N (02-06/11) Nhận 57 ngày 1.
    Lần 3. Chăn Btl 32 K5N (03-07/11) Nhận 32 ngày 5.
    Lần 4. Chăn Btl 14 K5N (08-12/11) Nhận MISS.
    Lần 5. Chăn Btl 82 K5N (13-17/11) Nhận 82 ngày 1.
    Lần 6. Chăn Btl 11 K5N (14-18/11) Nhận 11 ngày 2..
    Lần 7. Chăn Btl 56 K5N (16-20/11) Nhận 56 ngày 5.
    Lần 8. Chăn Btl 82 K5N (21-26/11) Nhận 82 ngày 1.
    Lần 9. Chăn Btl 23 K5N (22-26/11) Nhận 23 ngày 2.
    Lần 10. Chăn Btl 65 K5N (24-28/11) Nhận 65 ngày 2.

    Lần 11. Chăn Btl 60 K5N (26-30/11) Nhận 60 ngày 3.

    Lần 12. Chăn Btl 22 K5N (30-30/11) Nhận 22 ngày ...
    Tháng này chăn BTL K5N hết 5200d, trúng 1900d, lãi 37,6 tr.
     
  16. Bily123

    Bily123 Lính mới

    Tham gia:
    17/8/18
    Bài viết:
    1
    Được thích:
    0
    Điểm thành tích:
    0
    Bạn vào tiền như nào chia sẻ se tham khoả với
     
  17. rauduaquangay

    rauduaquangay Lính mới

    Tham gia:
    16/12/17
    Bài viết:
    132
    Được thích:
    286
    Điểm thành tích:
    63
    Chăn BTL k5n tháng 10/2018( chịu khó chăn kiếm ít cháo vậy)
    L1 : chăn 27 từ (01-05/10) nhận N1
    L2: chăn 33 từ (02-06/10) nhận N4 **
    L3: chăn 88 từ (06-10/10) nhận N2 khung này ko phải nghĩ băm to
    L4: chăn 25 từ (08-12/10) nhận N1 khung này chén cao
    L5:chăn 81 từ (09-13/10) nhận N3 chén nó
    L6:chăn 69 từ (12-16/10) nhận N1**
    L7:chăn 67 từ (13-17/10) nhận N4
    L8: chăn 94 từ (17-21/10) nhận N1.khung này to được
    L9: chăn 69 từ (18-22/10) nhận Xịt lòi tĩ
    L10: chăn 69 từ (23-27/10) nhận N.lại lòi trĩ
    L11: chăn 11 từ (28-31/10) đập chết cu đồng , ko ra a xin từ bỏ nghiệp lô đề cho mày chơi 1 mình Nhận N2
    L12: chăn 32 từ (30-31/10) ăn luôn ngày N1*** tận 3 nháy cơ à.
    L13: chăn 14 từ (31-31/10) nốt cuối tháng
     
    tienbossHaiphongtnvn123 thích điều này.
  18. minhlt

    minhlt Thành viên kiểm duyệt

    Tham gia:
    28/3/18
    Bài viết:
    78
    Được thích:
    123
    Điểm thành tích:
    33
    Lần 1. Chăn Btl 65 K5N (01-05/11)Nhận 65 ngày 1.
    Lần 2. Chăn Btl 57 K5N (02-06/11) Nhận 57 ngày 1.
    Lần 3. Chăn Btl 32 K5N (03-07/11) Nhận 32 ngày 5.
    Lần 4. Chăn Btl 14 K5N (08-12/11) Nhận MISS.
    Lần 5. Chăn Btl 82 K5N (13-17/11) Nhận 82 ngày 1.
    Lần 6. Chăn Btl 11 K5N (14-18/11) Nhận 11 ngày 2..
    Lần 7. Chăn Btl 56 K5N (16-20/11) Nhận 56 ngày 5.
    Lần 8. Chăn Btl 82 K5N (21-26/11) Nhận 82 ngày 1.
    Lần 9. Chăn Btl 23 K5N (22-26/11) Nhận 23 ngày 2.
    Lần 10. Chăn Btl 65 K5N (24-28/11) Nhận 65 ngày 2.

    Lần 11. Chăn Btl 60 K5N (26-30/11) Nhận 60 ngày 3.

    Lần 12. Chăn Btl 22 K5N (30-30/11) Nhận 22 ngày 1.
    Tháng này chăn BTL K5N hết 5200d, trúng 1900d, lãi 37,6 tr.

    Nay ăn 22 ngày 1. Tổng kết lãi 40,5 tr.
    Chia sẻ thêm tôi vào tiền: 50, 100, 200, 450, 600đ. lô 22 ăn 80.
    Mod quedau1981 duyệt thành viên kiểm duyệt cho tớ với, tớ đăng ký mấy hôm rồi.
     
    mrvic, tienboss, NguyenHaiNQ3 thành viên khác Thích điều này.
  19. Nguyenanh26

    Nguyenanh26 Thành viên kiểm duyệt

    Tham gia:
    31/7/18
    Bài viết:
    191
    Được thích:
    423
    Điểm thành tích:
    63
    Chăn BTL K5N tháng 10/2018.
    Lần 1: Chăn 03 từ 1-5/10/2018. Nhận 03 ngày 3
    Lần 2: Chăn 25 từ 4-8/10/2018. Nhận 25 ngày 5
    Lần 3: Chăn 31 từ 9-13/10/2018. Nhận 31 ngày 1
    Lần 4: Chăn 74 từ 10-14/10/2018. Nhận 74 ngày 2
    Lần 5: Chăn 57 từ 12-16/10/2018. Nhận 57** ngày 3
    Lần 6: Chăn 25 từ 15-19/10/2018. Nhận 25 ngày 1
    Lần 7: Chăn 21 từ 16-20/10/2018. Nhận 21 ngày 1
    Lần 8: Chăn 27 từ 17-21/10/2017. Nhận 27 ngày 2
    Lần 9: Chăn 42 từ 19-23/10/2018. Nhận 42** Ngày 3
    Lần 10: Chăn 53 từ 22-26/10/2018. Nhận 53 ngày 4
    Lần 11: Chăn 59 từ 26-31/10/2018. Nhận 59 ngày 5
    Lần 12: Chăn 28 từ 31-4/11/2018. Nhận.....
    Chúc AE may mắn.
     
    Minhbo1987 thích bài này.
  20. alisemiyen

    alisemiyen Thành viên kiểm duyệt

    Tham gia:
    3/8/11
    Bài viết:
    1,444
    Được thích:
    1,083
    Điểm thành tích:
    113
    Nghề nghiệp:
    số học
     
Trạng thái chủ đề:
Tạm đóng.

Cộng đồng Ketqua1.net